CAS 4831-21-4 appears in our catalog under these names: 2-((4-Bromophenyl)amino)-1-phenylethanone, 95+%, 2-(4-Bromoanilino)-1-phenyl-1-ethanone, 95%, 2-((4-bromophenyl)amino)-1-phenylethan-1-one. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 10g, 100mg, 5g, 250mg, 1g.
2-(4-bromoanilino)-1-phenylethanone (CAS 4831-21-4) is a chemical compound with the molecular formula C14H12BrNO and a molecular weight of 290.15 g/mol. IUPAC name: 2-(4-bromoanilino)-1-phenylethanone. InChIKey: LPKCHKLRDTZTHS-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO |
|---|---|
| Molecular weight | 290.15 g/mol |
| IUPAC name | 2-(4-bromoanilino)-1-phenylethanone |
| InChIKey | LPKCHKLRDTZTHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CNC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)