CAS 106757-36-2 is the registry number for (4R,5R)-4,5-Dimethyl-1,3,2-dioxathiolane 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(4R,5R)-4,5-dimethyl-1,3,2-dioxathiolane 2,2-dioxide (CAS 106757-36-2) is a chemical compound with the molecular formula C4H8O4S and a molecular weight of 152.17 g/mol. IUPAC name: (4R,5R)-4,5-dimethyl-1,3,2-dioxathiolane 2,2-dioxide. InChIKey: POVNYOLUWDFQOZ-QWWZWVQMSA-N.
| Molecular formula | C4H8O4S |
|---|---|
| Molecular weight | 152.17 g/mol |
| IUPAC name | (4R,5R)-4,5-dimethyl-1,3,2-dioxathiolane 2,2-dioxide |
| InChIKey | POVNYOLUWDFQOZ-QWWZWVQMSA-N |
| SMILES | C[C@@H]1[C@H](OS(=O)(=O)O1)C |
Computed by PubChem (NCBI)