CAS 14176-47-7 appears in our catalog under these names: Rel-(3R,4R)-3,4-dihydroxytetrahydrothiophene 1,1-dioxide, 98%, (3R,​4R)​-​rel-Tetrahydro-3,​4-​thiophenediol 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
(3R,4R)-1,1-dioxothiolane-3,4-diol (CAS 14176-47-7) is a chemical compound with the molecular formula C4H8O4S and a molecular weight of 152.17 g/mol. IUPAC name: (3R,4R)-1,1-dioxothiolane-3,4-diol. InChIKey: LDVDYVUZEKIBDP-IMJSIDKUSA-N.
| Molecular formula | C4H8O4S |
|---|---|
| Molecular weight | 152.17 g/mol |
| IUPAC name | (3R,4R)-1,1-dioxothiolane-3,4-diol |
| InChIKey | LDVDYVUZEKIBDP-IMJSIDKUSA-N |
| SMILES | C1[C@@H]([C@H](CS1(=O)=O)O)O |
Computed by PubChem (NCBI)