Products 1067630-53-8
CAS 1067630-53-8 is the registry number for 11-Cis-acitretin. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
(2E,4Z,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (CAS 1067630-53-8) is a chemical compound with the molecular formula C21H26O3 and a molecular weight of 326.4 g/mol. IUPAC name: (2E,4Z,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid. InChIKey: IHUNBGSDBOWDMA-CNPIXVCJSA-N.
| Molecular formula | C21H26O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (2E,4Z,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| InChIKey | IHUNBGSDBOWDMA-CNPIXVCJSA-N |
| SMILES | CC1=CC(=C(C(=C1/C=C/C(=C/C=C\C(=C\C(=O)O)\C)/C)C)C)OC |
Computed by PubChem (NCBI)
Synonyms:
11-cis-Acitretin, Acitretin Impurity 20