CAS 1067631-21-3 is the registry number for Benzyl (1s,2r)-2-aminocyclohexylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate (CAS 1067631-21-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate. InChIKey: FAIYTHASVJZIGQ-OLZOCXBDSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate |
| InChIKey | FAIYTHASVJZIGQ-OLZOCXBDSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)