CAS 199336-05-5 is the registry number for N-((1S,2S)-2-aminocyclohexyl)-Carbamic Acid Phenylmethyl Ester. Offered by: TRC. Available pack sizes: 500mg.
Benzyl N-[(1S,2S)-2-aminocyclohexyl]carbamate (CAS 199336-05-5) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-[(1S,2S)-2-aminocyclohexyl]carbamate. InChIKey: FAIYTHASVJZIGQ-STQMWFEESA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-[(1S,2S)-2-aminocyclohexyl]carbamate |
| InChIKey | FAIYTHASVJZIGQ-STQMWFEESA-N |
| SMILES | C1CC[C@@H]([C@H](C1)N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)