CAS 1067637-90-4 is the registry number for N-(5-(2-Bromoacetyl)thiazol-2-yl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide (CAS 1067637-90-4) is a chemical compound with the molecular formula C10H13BrN2O2S and a molecular weight of 305.19 g/mol. IUPAC name: N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide. InChIKey: BFIQLZUQBLETDO-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | N-[5-(2-bromoacetyl)-1,3-thiazol-2-yl]-2,2-dimethylpropanamide |
| InChIKey | BFIQLZUQBLETDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(S1)C(=O)CBr |
Computed by PubChem (NCBI)