Products 1211027-34-7
CAS 1211027-34-7 is the registry number for 3-Bromo-N-ethyl-N-(2-(methylamino)-2-oxoethyl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-ethyl-N-[2-(methylamino)-2-oxoethyl]thiophene-2-carboxamide (CAS 1211027-34-7) is a chemical compound with the molecular formula C10H13BrN2O2S and a molecular weight of 305.19 g/mol. IUPAC name: 3-bromo-N-ethyl-N-[2-(methylamino)-2-oxoethyl]thiophene-2-carboxamide. InChIKey: XUTYCSOZEMGGNE-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O2S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 3-bromo-N-ethyl-N-[2-(methylamino)-2-oxoethyl]thiophene-2-carboxamide |
| InChIKey | XUTYCSOZEMGGNE-UHFFFAOYSA-N |
| SMILES | CCN(CC(=O)NC)C(=O)C1=C(C=CS1)Br |
Computed by PubChem (NCBI)