Products 1067665-53-5
CAS 1067665-53-5 is the registry number for 2,2,2-Trifluoro-N-(3-(phenylmethoxy)phenyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,2,2-trifluoro-N-(3-phenylmethoxyphenyl)acetamide (CAS 1067665-53-5) is a chemical compound with the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. IUPAC name: 2,2,2-trifluoro-N-(3-phenylmethoxyphenyl)acetamide. InChIKey: NGXYSMHKGNYTDT-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO2 |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(3-phenylmethoxyphenyl)acetamide |
| InChIKey | NGXYSMHKGNYTDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)