Products 1858255-86-3
CAS 1858255-86-3 is the registry number for N-[4-Phenoxy-2-(trifluoromethyl)phenyl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[4-phenoxy-2-(trifluoromethyl)phenyl]acetamide (CAS 1858255-86-3) is a chemical compound with the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. IUPAC name: N-[4-phenoxy-2-(trifluoromethyl)phenyl]acetamide. InChIKey: FDCRQGPJYPYXRS-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO2 |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | N-[4-phenoxy-2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | FDCRQGPJYPYXRS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)OC2=CC=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)