Products 106788-05-0

CAS 106788-05-0 is the registry number for 5-(1-Methoxyethyl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(1-methoxyethyl)furan-2-carboxylic acid (CAS 106788-05-0) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 5-(1-methoxyethyl)furan-2-carboxylic acid. InChIKey: WDBRKQYWMHNCAC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4
Molecular weight170.16 g/mol
IUPAC name5-(1-methoxyethyl)furan-2-carboxylic acid
InChIKeyWDBRKQYWMHNCAC-UHFFFAOYSA-N
SMILESCC(C1=CC=C(O1)C(=O)O)OC

Computed by PubChem (NCBI)