CAS 106827-26-3 appears in our catalog under these names: 5-(2,3-Dichlorophenyl)-2-furaldehyde, 95%, 5-(2,3-dichlorophenyl)furan-2-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
5-(2,3-dichlorophenyl)furan-2-carbaldehyde (CAS 106827-26-3) is a chemical compound with the molecular formula C11H6Cl2O2 and a molecular weight of 241.07 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)furan-2-carbaldehyde. InChIKey: DFXHLUMKJNNXSE-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O2 |
|---|---|
| Molecular weight | 241.07 g/mol |
| IUPAC name | 5-(2,3-dichlorophenyl)furan-2-carbaldehyde |
| InChIKey | DFXHLUMKJNNXSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)