Products 92973-26-7

CAS 92973-26-7 is the registry number for 5-(3-Chlorophenyl)furan-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(3-chlorophenyl)furan-2-carbonyl chloride (CAS 92973-26-7) is a chemical compound with the molecular formula C11H6Cl2O2 and a molecular weight of 241.07 g/mol. IUPAC name: 5-(3-chlorophenyl)furan-2-carbonyl chloride. InChIKey: DBONYOXUBWINEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6Cl2O2
Molecular weight241.07 g/mol
IUPAC name5-(3-chlorophenyl)furan-2-carbonyl chloride
InChIKeyDBONYOXUBWINEQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C2=CC=C(O2)C(=O)Cl

Computed by PubChem (NCBI)