CAS 106847-40-9 appears in our catalog under these names: Norfloxacin Impurity 1, Pefloxacin EP Impurity H, 5-Chloro-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 106847-40-9) is a chemical compound with the molecular formula C12H9ClFNO3 and a molecular weight of 269.65 g/mol. IUPAC name: 5-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: MICBTFRMKYLDRZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO3 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | 5-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | MICBTFRMKYLDRZ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1C=CC(=C2Cl)F)C(=O)O |
Computed by PubChem (NCBI)