CAS 1244981-41-6 is the registry number for Ethyl 5-(2-chloro-4-fluorophenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(2-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylate (CAS 1244981-41-6) is a chemical compound with the molecular formula C12H9ClFNO3 and a molecular weight of 269.65 g/mol. IUPAC name: ethyl 5-(2-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: AGGBHMLGGHPYHO-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO3 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | ethyl 5-(2-chloro-4-fluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | AGGBHMLGGHPYHO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)