Products 106847-42-1

CAS 106847-42-1 is the registry number for Norfloxacin Impurity 16. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-ethyl-6-fluoro-4-oxo-5-piperazin-1-ylquinoline-3-carboxylic acid (CAS 106847-42-1) is a chemical compound with the molecular formula C16H18FN3O3 and a molecular weight of 319.33 g/mol. IUPAC name: 1-ethyl-6-fluoro-4-oxo-5-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: QEBWUEZHZCFZEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18FN3O3
Molecular weight319.33 g/mol
IUPAC name1-ethyl-6-fluoro-4-oxo-5-piperazin-1-ylquinoline-3-carboxylic acid
InChIKeyQEBWUEZHZCFZEJ-UHFFFAOYSA-N
SMILESCCN1C=C(C(=O)C2=C1C=CC(=C2N3CCNCC3)F)C(=O)O

Computed by PubChem (NCBI)