Products 1216601-32-9
CAS 1216601-32-9 appears in our catalog under these names: Norfloxacin-d8, Norfloxacin-d8, >95% (HPLC). Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2.5 mg.
1-ethyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (CAS 1216601-32-9) is a chemical compound with the molecular formula C16H18FN3O3 and a molecular weight of 327.38 g/mol. IUPAC name: 1-ethyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid. InChIKey: OGJPXUAPXNRGGI-SQUIKQQTSA-N.
| Molecular formula | C16H18FN3O3 |
|---|---|
| Molecular weight | 327.38 g/mol |
| IUPAC name | 1-ethyl-6-fluoro-7-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChIKey | OGJPXUAPXNRGGI-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)CC)F)([2H])[2H])[2H] |
Computed by PubChem (NCBI)