CAS 106946-74-1 appears in our catalog under these names: Boc–isoleucinol, Boc-L-Isoleucinol, N-Boc-L-isoleucinol, 95% , tert-Butyl ((2S,3S)-1-hydroxy-3-methylpentan-2-yl)carbamate 97%, Boc-Isoleucinol, 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Tert-butyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate (CAS 106946-74-1) is a chemical compound with the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate. InChIKey: BPLDQMXXYMKQPW-DTWKUNHWSA-N.
| Molecular formula | C11H23NO3 |
|---|---|
| Molecular weight | 217.31 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]carbamate |
| InChIKey | BPLDQMXXYMKQPW-DTWKUNHWSA-N |
| SMILES | CC[C@H](C)[C@@H](CO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)