Products 1343197-89-6

CAS 1343197-89-6 is the registry number for 3-(1-Methoxymethyl-butylamino)-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(1-methoxypentan-2-ylamino)propanoate (CAS 1343197-89-6) is a chemical compound with the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. IUPAC name: ethyl 3-(1-methoxypentan-2-ylamino)propanoate. InChIKey: GRQBLEVTPZPHLD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23NO3
Molecular weight217.31 g/mol
IUPAC nameethyl 3-(1-methoxypentan-2-ylamino)propanoate
InChIKeyGRQBLEVTPZPHLD-UHFFFAOYSA-N
SMILESCCCC(COC)NCCC(=O)OCC

Computed by PubChem (NCBI)