Products 1069652-05-6
CAS 1069652-05-6 is the registry number for 1-(2-(3-([1,1'-Biphenyl]-4-carbonyl)piperidine-1-carbonyl)phenyl)ethanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-[3-(4-phenylbenzoyl)piperidine-1-carbonyl]phenyl]ethanone (CAS 1069652-05-6) is a chemical compound with the molecular formula C27H25NO3 and a molecular weight of 411.5 g/mol. IUPAC name: 1-[2-[3-(4-phenylbenzoyl)piperidine-1-carbonyl]phenyl]ethanone. InChIKey: LTZQJWJXEKNDJW-UHFFFAOYSA-N.
| Molecular formula | C27H25NO3 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 1-[2-[3-(4-phenylbenzoyl)piperidine-1-carbonyl]phenyl]ethanone |
| InChIKey | LTZQJWJXEKNDJW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1C(=O)N2CCCC(C2)C(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)