CAS 2646622-01-5 is the registry number for (S)-2'-(tert-Butyl(methyl)carbamoyl)-[1,1'-binaphthalene]-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-[tert-butyl(methyl)carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid (CAS 2646622-01-5) is a chemical compound with the molecular formula C27H25NO3 and a molecular weight of 411.5 g/mol. IUPAC name: 1-[2-[tert-butyl(methyl)carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid. InChIKey: UIETZHIJMLZIBP-UHFFFAOYSA-N.
| Molecular formula | C27H25NO3 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 1-[2-[tert-butyl(methyl)carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid |
| InChIKey | UIETZHIJMLZIBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(C)C(=O)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)