CAS 107021-36-3 appears in our catalog under these names: Prazobind, 95%, Prazobind, Prazobind, 96.20%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 1mg, 1 mg, 5 mg.
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2-bicyclo[2.2.2]octa-2,5-dienyl)methanone (CAS 107021-36-3) is a chemical compound with the molecular formula C23H27N5O3 and a molecular weight of 421.5 g/mol. IUPAC name: [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2-bicyclo[2.2.2]octa-2,5-dienyl)methanone. InChIKey: MXXRJJCMLRPJOF-UHFFFAOYSA-N.
| Molecular formula | C23H27N5O3 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2-bicyclo[2.2.2]octa-2,5-dienyl)methanone |
| InChIKey | MXXRJJCMLRPJOF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4=CC5CCC4C=C5)N)OC |
Computed by PubChem (NCBI)