Products 1795787-14-2
CAS 1795787-14-2 is the registry number for Valsartan Impurity 105. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[butanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoic acid (CAS 1795787-14-2) is a chemical compound with the molecular formula C23H27N5O3 and a molecular weight of 421.5 g/mol. IUPAC name: (2R)-2-[butanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoic acid. InChIKey: OKAQHVJSXLGXET-OAQYLSRUSA-N.
| Molecular formula | C23H27N5O3 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | (2R)-2-[butanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methylbutanoic acid |
| InChIKey | OKAQHVJSXLGXET-OAQYLSRUSA-N |
| SMILES | CCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3)[C@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)