CAS 107047-29-0 is the registry number for 2,4-Dichloro-6-(trifluoromethyl)phenylhydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[2,4-dichloro-6-(trifluoromethyl)phenyl]hydrazine (CAS 107047-29-0) is a chemical compound with the molecular formula C7H5Cl2F3N2 and a molecular weight of 245.03 g/mol. IUPAC name: [2,4-dichloro-6-(trifluoromethyl)phenyl]hydrazine. InChIKey: ULVONSNGBHOIOM-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F3N2 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | [2,4-dichloro-6-(trifluoromethyl)phenyl]hydrazine |
| InChIKey | ULVONSNGBHOIOM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)NN)Cl)Cl |
Computed by PubChem (NCBI)