CAS 1337081-59-0 is the registry number for 1-(2,6-Dichloropyridin-4-yl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-(2,6-dichloro-4-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1337081-59-0) is a chemical compound with the molecular formula C7H5Cl2F3N2 and a molecular weight of 245.03 g/mol. IUPAC name: 1-(2,6-dichloro-4-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: HJHOOFVIJVDMHV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2F3N2 |
|---|---|
| Molecular weight | 245.03 g/mol |
| IUPAC name | 1-(2,6-dichloro-4-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | HJHOOFVIJVDMHV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)