Products 1070660-34-2
CAS 1070660-34-2 appears in our catalog under these names: N-Desmethyl Rivastigmine, N-Ethylcarbamic Acid 3-((1S)-1-(Dimethylamino)ethyl)phenyl Ester, N-Ethylcarbamic acid 3-((1S)-1-(dimethylamino)ethyl)phenyl ester-d6, Rivastigmine impurity 1. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 500mg, 50mg, 250mg, 100mg, Get quote.
[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethylcarbamate (CAS 1070660-34-2) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethylcarbamate. InChIKey: UBMYZKQTEJHAKE-JTQLQIEISA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethylcarbamate |
| InChIKey | UBMYZKQTEJHAKE-JTQLQIEISA-N |
| SMILES | CCNC(=O)OC1=CC=CC(=C1)[C@H](C)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
N-Ethylcarbamic Acid 3-[(1S)-1-(Dimethylamino)ethyl]phenyl Ester, [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethylcarbamate, 3-[(1S)-1-(dimethylamino)ethyl]phenyl N-ethylcarbamate, (S)-3-(1-(Dimethylamino)ethyl)phenyl ethylcarbamate, N-Desmethyl Rivastigmine, Rivastigmine RC 5, Carbamic acid, N-ethyl-, 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester