Products 1070774-29-6

CAS 1070774-29-6 appears in our catalog under these names: (3-Fluoropyridin-2-yl)boronic acid 98%, (3-Fluoropyridin-2-yl)boronic acid, 98%, 98%, (3-FLUOROPYRIDIN-2-YL)BORONIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3-fluoro-2-pyridinyl)boronic acid (CAS 1070774-29-6) is a chemical compound with the molecular formula C5H5BFNO2 and a molecular weight of 140.91 g/mol. IUPAC name: (3-fluoro-2-pyridinyl)boronic acid. InChIKey: LTAUVGYDXJTVQB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BFNO2
Molecular weight140.91 g/mol
IUPAC name(3-fluoro-2-pyridinyl)boronic acid
InChIKeyLTAUVGYDXJTVQB-UHFFFAOYSA-N
SMILESB(C1=C(C=CC=N1)F)(O)O

Computed by PubChem (NCBI)