Products 860626-80-8

CAS 860626-80-8 is the registry number for 4-Fluoropyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

(4-fluoro-3-pyridinyl)boronic acid (CAS 860626-80-8) is a chemical compound with the molecular formula C5H5BFNO2 and a molecular weight of 140.91 g/mol. IUPAC name: (4-fluoro-3-pyridinyl)boronic acid. InChIKey: FJHZOURNTIVCIA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5BFNO2
Molecular weight140.91 g/mol
IUPAC name(4-fluoro-3-pyridinyl)boronic acid
InChIKeyFJHZOURNTIVCIA-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1)F)(O)O

Computed by PubChem (NCBI)