CAS 1070879-47-8 appears in our catalog under these names: 4-Bromo-6-fluoro-2-methylquinoline, 98%, 4-Bromo-6-fluoro-2-methylquinoline. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
4-bromo-6-fluoro-2-methylquinoline (CAS 1070879-47-8) is a chemical compound with the molecular formula C10H7BrFN and a molecular weight of 240.07 g/mol. IUPAC name: 4-bromo-6-fluoro-2-methylquinoline. InChIKey: PNUZBHRKDCGEIY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFN |
|---|---|
| Molecular weight | 240.07 g/mol |
| IUPAC name | 4-bromo-6-fluoro-2-methylquinoline |
| InChIKey | PNUZBHRKDCGEIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)F)Br |
Computed by PubChem (NCBI)