Products 1565984-98-6
CAS 1565984-98-6 appears in our catalog under these names: 1-(3-Bromo-4-fluorophenyl)-1h-pyrrole, 95%, 1-(3-Bromo-4-fluorophenyl)-1H-pyrrole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(3-bromo-4-fluorophenyl)pyrrole (CAS 1565984-98-6) is a chemical compound with the molecular formula C10H7BrFN and a molecular weight of 240.07 g/mol. IUPAC name: 1-(3-bromo-4-fluorophenyl)pyrrole. InChIKey: UAGBAMPTFGWJJF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFN |
|---|---|
| Molecular weight | 240.07 g/mol |
| IUPAC name | 1-(3-bromo-4-fluorophenyl)pyrrole |
| InChIKey | UAGBAMPTFGWJJF-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)