Products 107156-22-9
CAS 107156-22-9 is the registry number for Trimethyl 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tribenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[4,6-bis(4-methoxycarbonylphenyl)-1,3,5-triazin-2-yl]benzoate (CAS 107156-22-9) is a chemical compound with the molecular formula C27H21N3O6 and a molecular weight of 483.5 g/mol. IUPAC name: methyl 4-[4,6-bis(4-methoxycarbonylphenyl)-1,3,5-triazin-2-yl]benzoate. InChIKey: HCIAYDJMUVFEAG-UHFFFAOYSA-N.
| Molecular formula | C27H21N3O6 |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | methyl 4-[4,6-bis(4-methoxycarbonylphenyl)-1,3,5-triazin-2-yl]benzoate |
| InChIKey | HCIAYDJMUVFEAG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)C(=O)OC)C4=CC=C(C=C4)C(=O)OC |
Computed by PubChem (NCBI)