Products 1258012-29-1
CAS 1258012-29-1 appears in our catalog under these names: 4,4',4''-(Benzene-1,3,5-triyltris(azanediyl))tribenzoic acid, 97%, 97%, 4,4',4''-(Benzene-1,3,5-triyltris(azanediyl))tribenzoic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[3,5-bis(4-carboxyanilino)anilino]benzoic acid (CAS 1258012-29-1) is a chemical compound with the molecular formula C27H21N3O6 and a molecular weight of 483.5 g/mol. IUPAC name: 4-[3,5-bis(4-carboxyanilino)anilino]benzoic acid. InChIKey: QPDKZYKUPNCXJF-UHFFFAOYSA-N.
| Molecular formula | C27H21N3O6 |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | 4-[3,5-bis(4-carboxyanilino)anilino]benzoic acid |
| InChIKey | QPDKZYKUPNCXJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC2=CC(=CC(=C2)NC3=CC=C(C=C3)C(=O)O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)