CAS 1071727-49-5 appears in our catalog under these names: 6-Bromo-7-methyl-2,3-dihydro-1h-inden-1-one, 95%, 6–Bromo–7–methyl–2,3–dihydro–1H–inden–1–one, 6-Bromo-7-methyl-2,3-indan-1-one, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 500mg, 5g.
6-bromo-7-methyl-2,3-dihydroinden-1-one (CAS 1071727-49-5) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-7-methyl-2,3-dihydroinden-1-one. InChIKey: VYCICRIMTRDJBO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-7-methyl-2,3-dihydroinden-1-one |
| InChIKey | VYCICRIMTRDJBO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)CC2)Br |
Computed by PubChem (NCBI)