Products 1071866-31-3
CAS 1071866-31-3 is the registry number for 6-({((tert-Butoxy)carbonyl)(methyl)amino}methyl)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyridine-3-carboxylic acid (CAS 1071866-31-3) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: 6-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyridine-3-carboxylic acid. InChIKey: HZVCTQAAIJBRBQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 6-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyridine-3-carboxylic acid |
| InChIKey | HZVCTQAAIJBRBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)