CAS 1071929-03-7 appears in our catalog under these names: Dl-dapoxetine hydrochloride, 95%, DL-Dapoxetine HCl, DL-Dapoxetine Hydrochloride, >95% (HPLC), DL–Dapoxetine (hydrochloride), Dapoxetine HCl, mixture of enantiomers. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, on request, 2,5g, 500mg, 250mg.
N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride (CAS 1071929-03-7) is a chemical compound with the molecular formula C21H24ClNO and a molecular weight of 341.9 g/mol. IUPAC name: N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride. InChIKey: IHWDIQRWYNMKFM-UHFFFAOYSA-N.
| Molecular formula | C21H24ClNO |
|---|---|
| Molecular weight | 341.9 g/mol |
| IUPAC name | N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | IHWDIQRWYNMKFM-UHFFFAOYSA-N |
| SMILES | CN(C)C(CCOC1=CC=CC2=CC=CC=C21)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)