Products 129938-20-1
CAS 129938-20-1 appears in our catalog under these names: Dapoxetine HCl, Dapoxetine Hydrochloride, Dapoxetine Hydrochloride, >95% (HPLC), Dapoxetine–D7 hydrochloride, Dapoxetine HCl. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 500mg, 250mg, 5mg, 50mg, 25mg.
(1S)-N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride (CAS 129938-20-1) is a chemical compound with the molecular formula C21H24ClNO and a molecular weight of 341.9 g/mol. IUPAC name: (1S)-N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride. InChIKey: IHWDIQRWYNMKFM-BDQAORGHSA-N.
| Molecular formula | C21H24ClNO |
|---|---|
| Molecular weight | 341.9 g/mol |
| IUPAC name | (1S)-N,N-dimethyl-3-naphthalen-1-yloxy-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | IHWDIQRWYNMKFM-BDQAORGHSA-N |
| SMILES | CN(C)[C@@H](CCOC1=CC=CC2=CC=CC=C21)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)
Synonyms:
Dapoxetine hydrochloride, Dapoxetine HCl, Dapoxetine (as hydrochloride), Priligy, (S)-N,N-Dimethyl-3-(naphthalen-1-yloxy)-1-phenylpropan-1-amine hydrochloride, Dapoxetine hydrochloride [USAN], Dapoxetine (hydrochloride), (+)-Dapoxetine hydrochloride, Dapoxetine hydrochloride, >=98% (HPLC), Dapoxetine hydrochloride (USAN)