CAS 1072249-83-2 is the registry number for tert–Butyl 3–methyl–1H–pyrazolo(4,3–c)pyridine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl 3-methylpyrazolo[4,5-c]pyridine-1-carboxylate (CAS 1072249-83-2) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: tert-butyl 3-methylpyrazolo[4,5-c]pyridine-1-carboxylate. InChIKey: HDNIJXKDCMMNPM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | tert-butyl 3-methylpyrazolo[4,5-c]pyridine-1-carboxylate |
| InChIKey | HDNIJXKDCMMNPM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=NC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)