CAS 107274-76-0 is the registry number for 4-(6-Chloroquinolin-2-yl)-N,N-dimethylaniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
4-(6-chloroquinolin-2-yl)-N,N-dimethylaniline (CAS 107274-76-0) is a chemical compound with the molecular formula C17H15ClN2 and a molecular weight of 282.8 g/mol. IUPAC name: 4-(6-chloroquinolin-2-yl)-N,N-dimethylaniline. InChIKey: HAFRTZKCGPFBQX-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 4-(6-chloroquinolin-2-yl)-N,N-dimethylaniline |
| InChIKey | HAFRTZKCGPFBQX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)