CAS 1159988-47-2 is the registry number for 4-Chloro-3,5-bis(4-methylphenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-chloro-3,5-bis(4-methylphenyl)-1H-pyrazole (CAS 1159988-47-2) is a chemical compound with the molecular formula C17H15ClN2 and a molecular weight of 282.8 g/mol. IUPAC name: 4-chloro-3,5-bis(4-methylphenyl)-1H-pyrazole. InChIKey: BXSCVNJLFJAVFZ-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 4-chloro-3,5-bis(4-methylphenyl)-1H-pyrazole |
| InChIKey | BXSCVNJLFJAVFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C(=NN2)C3=CC=C(C=C3)C)Cl |
Computed by PubChem (NCBI)