Products 107276-46-0
CAS 107276-46-0 appears in our catalog under these names: N-(2,5-Diethoxyphenyl)-4-methyl-benzenesulfonamide, 95%, N–(2，5–Diethoxyphenyl)–4–methylbenzenesulfonamide. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
N-(2,5-diethoxyphenyl)-4-methylbenzenesulfonamide (CAS 107276-46-0) is a chemical compound with the molecular formula C17H21NO4S and a molecular weight of 335.4 g/mol. IUPAC name: N-(2,5-diethoxyphenyl)-4-methylbenzenesulfonamide. InChIKey: FWKRHCHBOMKVFW-UHFFFAOYSA-N.
| Molecular formula | C17H21NO4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-(2,5-diethoxyphenyl)-4-methylbenzenesulfonamide |
| InChIKey | FWKRHCHBOMKVFW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)OCC)NS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)