CAS 190190-48-8 appears in our catalog under these names: Boc-(r)-3-amino-4-(3-benzothienyl)-butyric acid, 95%, Boc-β-D-2-Abu(Benzo[b]thiophen-3-yl)-OH 98%, (R)-4-(Benzo[b]thiophen-3-yl)-3-((tert-butoxycarbonyl)amino)butanoic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3R)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 190190-48-8) is a chemical compound with the molecular formula C17H21NO4S and a molecular weight of 335.4 g/mol. IUPAC name: (3R)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VRUFHPBCNHYEPJ-GFCCVEGCSA-N.
| Molecular formula | C17H21NO4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (3R)-4-(1-benzothiophen-3-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VRUFHPBCNHYEPJ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CSC2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)