CAS 107285-30-3 is the registry number for Loratadine Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide (CAS 107285-30-3) is a chemical compound with the molecular formula C18H21ClN2O and a molecular weight of 316.8 g/mol. IUPAC name: N-tert-butyl-3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide. InChIKey: DYZFUWRIGTVCKS-UHFFFAOYSA-N.
| Molecular formula | C18H21ClN2O |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | N-tert-butyl-3-[2-(3-chlorophenyl)ethyl]pyridine-2-carboxamide |
| InChIKey | DYZFUWRIGTVCKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(C=CC=N1)CCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)