CAS 1147199-72-1 is the registry number for 2-[5-(BENZYLOXY)-2-METHYL-1H-INDOL-3-YL]ETHANAMINE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1147199-72-1) is a chemical compound with the molecular formula C18H21ClN2O and a molecular weight of 316.8 g/mol. IUPAC name: 2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: FMWOWTNPQWIRQN-UHFFFAOYSA-N.
| Molecular formula | C18H21ClN2O |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | 2-(2-methyl-5-phenylmethoxy-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | FMWOWTNPQWIRQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)OCC3=CC=CC=C3)CCN.Cl |
Computed by PubChem (NCBI)