CAS 1072944-68-3 is the registry number for Methyl 8-bromo-4-chloroquinoline-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 8-bromo-4-chloroquinoline-2-carboxylate (CAS 1072944-68-3) is a chemical compound with the molecular formula C11H7BrClNO2 and a molecular weight of 300.53 g/mol. IUPAC name: methyl 8-bromo-4-chloroquinoline-2-carboxylate. InChIKey: MRNWDAGFVWSOAL-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClNO2 |
|---|---|
| Molecular weight | 300.53 g/mol |
| IUPAC name | methyl 8-bromo-4-chloroquinoline-2-carboxylate |
| InChIKey | MRNWDAGFVWSOAL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C=CC=C2Br)C(=C1)Cl |
Computed by PubChem (NCBI)