Products 1340075-78-6

CAS 1340075-78-6 is the registry number for 5-Bromo-4-chloro-8-methylquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-4-chloro-8-methylquinoline-2-carboxylic acid (CAS 1340075-78-6) is a chemical compound with the molecular formula C11H7BrClNO2 and a molecular weight of 300.53 g/mol. IUPAC name: 5-bromo-4-chloro-8-methylquinoline-2-carboxylic acid. InChIKey: POQKYRXCAIGSTK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7BrClNO2
Molecular weight300.53 g/mol
IUPAC name5-bromo-4-chloro-8-methylquinoline-2-carboxylic acid
InChIKeyPOQKYRXCAIGSTK-UHFFFAOYSA-N
SMILESCC1=C2C(=C(C=C1)Br)C(=CC(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)