Products 1072945-58-4
CAS 1072945-58-4 is the registry number for 3-Ethoxy-2-fluoro-6-nitroanisole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-ethoxy-2-fluoro-3-methoxy-4-nitrobenzene (CAS 1072945-58-4) is a chemical compound with the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. IUPAC name: 1-ethoxy-2-fluoro-3-methoxy-4-nitrobenzene. InChIKey: YCZOCLPRDIJFAL-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4 |
|---|---|
| Molecular weight | 215.18 g/mol |
| IUPAC name | 1-ethoxy-2-fluoro-3-methoxy-4-nitrobenzene |
| InChIKey | YCZOCLPRDIJFAL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)[N+](=O)[O-])OC)F |
Computed by PubChem (NCBI)