CAS 1131605-32-7 is the registry number for 1,3–Propanediol, 2–(2–fluoro–6–nitrophenyl)–. Offered by: GLPBio. Available pack sizes: 200mg.
2-(2-fluoro-6-nitrophenyl)propane-1,3-diol (CAS 1131605-32-7) is a chemical compound with the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. IUPAC name: 2-(2-fluoro-6-nitrophenyl)propane-1,3-diol. InChIKey: CAMRYBIYYCRTJR-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4 |
|---|---|
| Molecular weight | 215.18 g/mol |
| IUPAC name | 2-(2-fluoro-6-nitrophenyl)propane-1,3-diol |
| InChIKey | CAMRYBIYYCRTJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(CO)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)