CAS 1072946-41-8 is the registry number for 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]boronic acid (CAS 1072946-41-8) is a chemical compound with the molecular formula C9H9BF2O4 and a molecular weight of 229.98 g/mol. IUPAC name: [4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]boronic acid. InChIKey: GTBJZTQCEQYQLQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BF2O4 |
|---|---|
| Molecular weight | 229.98 g/mol |
| IUPAC name | [4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]boronic acid |
| InChIKey | GTBJZTQCEQYQLQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C2OCCO2)F)(O)O |
Computed by PubChem (NCBI)