Products 2377605-88-2

CAS 2377605-88-2 is the registry number for 4-(Ethoxycarbonyl)-2,6-difluorophenylboronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid (CAS 2377605-88-2) is a chemical compound with the molecular formula C9H9BF2O4 and a molecular weight of 229.98 g/mol. IUPAC name: (4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid. InChIKey: OBBKPJAOKAPQJL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BF2O4
Molecular weight229.98 g/mol
IUPAC name(4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid
InChIKeyOBBKPJAOKAPQJL-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1F)C(=O)OCC)F)(O)O

Computed by PubChem (NCBI)