CAS 2377605-88-2 is the registry number for 4-(Ethoxycarbonyl)-2,6-difluorophenylboronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid (CAS 2377605-88-2) is a chemical compound with the molecular formula C9H9BF2O4 and a molecular weight of 229.98 g/mol. IUPAC name: (4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid. InChIKey: OBBKPJAOKAPQJL-UHFFFAOYSA-N.
| Molecular formula | C9H9BF2O4 |
|---|---|
| Molecular weight | 229.98 g/mol |
| IUPAC name | (4-ethoxycarbonyl-2,6-difluorophenyl)boronic acid |
| InChIKey | OBBKPJAOKAPQJL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)OCC)F)(O)O |
Computed by PubChem (NCBI)