CAS 2304633-92-7 appears in our catalog under these names: (2,3,4-Trifluoro-5-hydroxyphenyl)boronic acid, 95%, (2,3,4-Trifluoro-5-hydroxyphenyl)boronic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 750mg.
(2,3,4-trifluoro-5-hydroxyphenyl)boronic acid (CAS 2304633-92-7) is a chemical compound with the molecular formula C6H4BF3O3 and a molecular weight of 191.90 g/mol. IUPAC name: (2,3,4-trifluoro-5-hydroxyphenyl)boronic acid. InChIKey: IXEBLDLKOBUEJP-UHFFFAOYSA-N.
| Molecular formula | C6H4BF3O3 |
|---|---|
| Molecular weight | 191.90 g/mol |
| IUPAC name | (2,3,4-trifluoro-5-hydroxyphenyl)boronic acid |
| InChIKey | IXEBLDLKOBUEJP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)F)O)(O)O |
Computed by PubChem (NCBI)